C32H36N10O6 — CID 91545154
tert-butyl 4-(5-amino-1-methylindazol-3-yl)pyrazole-1-carboxylate;tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate (PubChem CID 91545154) has the molecular formula C32H36N10O6 and a molecular weight of 656.70 g/mol. Its IUPAC name is tert-butyl 4-(5-amino-1-methylindazol-3-yl)pyrazole-1-carboxylate;tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-(5-amino-1-methylindazol-3-yl)pyrazole-1-carboxylate;tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 91545154 |
| Molecular Formula | C32H36N10O6 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | tert-butyl 4-(5-amino-1-methylindazol-3-yl)pyrazole-1-carboxylate;tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate |
| SMILES | Cn1nc(-c2cnn(C(=O)OC(C)(C)C)c2)c2cc(N)ccc21.Cn1nc(-c2cnn(C(=O)OC(C)(C)C)c2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H17N5O4.C16H19N5O2/c1-16(2,3)25-15(22)20-9-10(8-17-20)14-12-7-11(21(23)24)5-6-13(12)19(4)18-14;1-16(2,3)23-15(22)21-9-10(8-18-21)14-12-7-11(17)5-6-13(12)20(4)19-14/h5-9H,1-4H3;5-9H,17H2,1-4H3 |
| InChIKey | OPXCHDQLLRMKIH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|