C19H24FN3O2 — CID 9154560
(2R)-N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-(4-fluorophenoxy)propanamide (PubChem CID 9154560) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is (2R)-N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-(4-fluorophenoxy)propanamide.
| Compound Name | (2R)-N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-(4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 9154560 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (2R)-N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-(4-fluorophenoxy)propanamide |
| SMILES | Cc1cc(/C=N\NC(=O)[C@@H](C)Oc2ccc(F)cc2)c(C)n1C(C)C |
| InChI | InChI=1S/C19H24FN3O2/c1-12(2)23-13(3)10-16(14(23)4)11-21-22-19(24)15(5)25-18-8-6-17(20)7-9-18/h6-12,15H,1-5H3,(H,22,24)/b21-11-/t15-/m1/s1 |
| InChIKey | OKQUWZBEWUPKEO-ZGFXFUDXSA-N |
| XLogP | 3.74 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|