About N-(6,6-dimethylazepin-3-yl)acetamide
N-(6,6-dimethylazepin-3-yl)acetamide (PubChem CID 91545694) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is N-(6,6-dimethylazepin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(6,6-dimethylazepin-3-yl)acetamide |
| PubChem CID | 91545694 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N-(6,6-dimethylazepin-3-yl)acetamide |
| SMILES | CC(=O)NC1=CN=CC(C)(C)C=C1 |
| InChI | InChI=1S/C10H14N2O/c1-8(13)12-9-4-5-10(2,3)7-11-6-9/h4-7H,1-3H3,(H,12,13) |
| InChIKey | HPKMIPFOTXQGTB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6,6-dimethylazepin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,6-dimethylazepin-3-yl)acetamide?
The IUPAC name of N-(6,6-dimethylazepin-3-yl)acetamide (CID 91545694) is N-(6,6-dimethylazepin-3-yl)acetamide.
What is the SMILES notation for N-(6,6-dimethylazepin-3-yl)acetamide?
The canonical SMILES for N-(6,6-dimethylazepin-3-yl)acetamide is CC(=O)NC1=CN=CC(C)(C)C=C1.
What is the InChIKey of N-(6,6-dimethylazepin-3-yl)acetamide?
The InChIKey is HPKMIPFOTXQGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-8(13)12-9-4-5-10(2,3)7-11-6-9/h4-7H,1-3H3,(H,12,13).
What are the key properties of N-(6,6-dimethylazepin-3-yl)acetamide?
N-(6,6-dimethylazepin-3-yl)acetamide has a molecular weight of 178.23 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,6-dimethylazepin-3-yl)acetamide is sourced from PubChem (CID 91545694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).