About 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole
2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole (PubChem CID 91545902) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole |
| PubChem CID | 91545902 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole |
| SMILES | C1COC(CCC2NCCO2)=N1 |
| InChI | InChI=1S/C8H14N2O2/c1(7-9-3-5-11-7)2-8-10-4-6-12-8/h7,9H,1-6H2 |
| InChIKey | OSRXFAULPMCCDK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole (CID 91545902) is 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole is C1COC(CCC2NCCO2)=N1.
What is the InChIKey of 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole?
The InChIKey is OSRXFAULPMCCDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1(7-9-3-5-11-7)2-8-10-4-6-12-8/h7,9H,1-6H2.
What are the key properties of 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole?
2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole has a molecular weight of 170.21 g/mol, XLogP of 0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-oxazolidin-2-yl)ethyl]-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 91545902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).