About 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol
2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol (PubChem CID 91546128) has the molecular formula C19H29F3O3
and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol |
| PubChem CID | 91546128 |
| Molecular Formula | C19H29F3O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol |
| SMILES | CC1C2CC(C1C)C(C(=O)OC1CC3CCC1C3)(C(F)(F)F)C2.CO |
| InChI | InChI=1S/C18H25F3O2.CH4O/c1-9-10(2)14-7-13(9)8-17(14,18(19,20)21)16(22)23-15-6-11-3-4-12(15)5-11;1-2/h9-15H,3-8H2,1-2H3;2H,1H3 |
| InChIKey | HFMLEFZEKRZVOQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol (CID 91546128) is 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol is CC1C2CC(C1C)C(C(=O)OC1CC3CCC1C3)(C(F)(F)F)C2.CO.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol?
The InChIKey is HFMLEFZEKRZVOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F3O2.CH4O/c1-9-10(2)14-7-13(9)8-17(14,18(19,20)21)16(22)23-15-6-11-3-4-12(15)5-11;1-2/h9-15H,3-8H2,1-2H3;2H,1H3.
What are the key properties of 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol?
2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol has a molecular weight of 362.43 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;methanol is sourced from PubChem (CID 91546128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).