About bicyclo[3.3.1]nonane-2,3,4-trione
bicyclo[3.3.1]nonane-2,3,4-trione (PubChem CID 91546154) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is bicyclo[3.3.1]nonane-2,3,4-trione.
Molecular Properties
| Compound Name | bicyclo[3.3.1]nonane-2,3,4-trione |
| PubChem CID | 91546154 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | bicyclo[3.3.1]nonane-2,3,4-trione |
| SMILES | O=C1C(=O)C2CCCC(C2)C1=O |
| InChI | InChI=1S/C9H10O3/c10-7-5-2-1-3-6(4-5)8(11)9(7)12/h5-6H,1-4H2 |
| InChIKey | WDQFUYBOCKDWNY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.3.1]nonane-2,3,4-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.3.1]nonane-2,3,4-trione?
The IUPAC name of bicyclo[3.3.1]nonane-2,3,4-trione (CID 91546154) is bicyclo[3.3.1]nonane-2,3,4-trione.
What is the SMILES notation for bicyclo[3.3.1]nonane-2,3,4-trione?
The canonical SMILES for bicyclo[3.3.1]nonane-2,3,4-trione is O=C1C(=O)C2CCCC(C2)C1=O.
What is the InChIKey of bicyclo[3.3.1]nonane-2,3,4-trione?
The InChIKey is WDQFUYBOCKDWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-7-5-2-1-3-6(4-5)8(11)9(7)12/h5-6H,1-4H2.
What are the key properties of bicyclo[3.3.1]nonane-2,3,4-trione?
bicyclo[3.3.1]nonane-2,3,4-trione has a molecular weight of 166.18 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.3.1]nonane-2,3,4-trione is sourced from PubChem (CID 91546154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).