C10H16O7 — CID 91546375
(3S,4R,5R)-1-(2,5-dihydrofuran-2-yl)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 91546375) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is (3S,4R,5R)-1-(2,5-dihydrofuran-2-yl)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | (3S,4R,5R)-1-(2,5-dihydrofuran-2-yl)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 91546375 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (3S,4R,5R)-1-(2,5-dihydrofuran-2-yl)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(C(O)C1C=CCO1)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O7/c11-4-5(12)7(13)9(15)10(16)8(14)6-2-1-3-17-6/h1-2,5-9,11-15H,3-4H2/t5-,6?,7-,8?,9+/m1/s1 |
| InChIKey | COJSJKKWBYYDSQ-DRVRTCHJSA-N |
| XLogP | -3.05 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|