C5H11N — CID 91546557
1,2,2,3,3,4,4,5,5-nonadeuteriopiperidine (PubChem CID 91546557) has the molecular formula C5H11N and a molecular weight of 94.20 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5-nonadeuteriopiperidine.
| Compound Name | 1,2,2,3,3,4,4,5,5-nonadeuteriopiperidine |
|---|---|
| PubChem CID | 91546557 |
| Molecular Formula | C5H11N |
| Molecular Weight | 94.20 g/mol |
| Exact Mass | 94.15 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5-nonadeuteriopiperidine |
| SMILES | [2H]N1CC([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C5H11N/c1-2-4-6-5-3-1/h6H,1-5H2/i1D2,2D2,3D2,4D2/hD |
| InChIKey | NQRYJNQNLNOLGT-KLRAWXKOSA-N |
| XLogP | 0.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |