C38H36ClFN6O4S — CID 91546727
1-[2-(2-chloro-6-fluorophenyl)ethyl]-1,2-bis[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]-2-(2-thiophen-2-ylethyl)hydrazine (PubChem CID 91546727) has the molecular formula C38H36ClFN6O4S and a molecular weight of 727.26 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)ethyl]-1,2-bis[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]-2-(2-thiophen-2-ylethyl)hydrazine.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-1,2-bis[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]-2-(2-thiophen-2-ylethyl)hydrazine |
|---|---|
| PubChem CID | 91546727 |
| Molecular Formula | C38H36ClFN6O4S |
| Molecular Weight | 727.26 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-1,2-bis[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]-2-(2-thiophen-2-ylethyl)hydrazine |
| SMILES | COc1cccc(-c2cc(N(CCc3cccs3)N(CCc3c(F)cccc3Cl)c3cc(-c4cccc(OC)c4)nc(OC)n3)nc(OC)n2)c1 |
| InChI | InChI=1S/C38H36ClFN6O4S/c1-47-27-11-5-9-25(21-27)33-23-35(43-37(41-33)49-3)45(18-16-29-13-8-20-51-29)46(19-17-30-31(39)14-7-15-32(30)40)36-24-34(42-38(44-36)50-4)26-10-6-12-28(22-26)48-2/h5-15,20-24H,16-19H2,1-4H3 |
| InChIKey | LGZFFJWMRBOCFB-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 94.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.26 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|