C22H23F6N3O2 — CID 91547390
N-tert-butyl-2-[3-methyl-2-nitroso-4-(2,4,5-trifluorophenyl)butyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 91547390) has the molecular formula C22H23F6N3O2 and a molecular weight of 475.43 g/mol. Its IUPAC name is N-tert-butyl-2-[3-methyl-2-nitroso-4-(2,4,5-trifluorophenyl)butyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-tert-butyl-2-[3-methyl-2-nitroso-4-(2,4,5-trifluorophenyl)butyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91547390 |
| Molecular Formula | C22H23F6N3O2 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-tert-butyl-2-[3-methyl-2-nitroso-4-(2,4,5-trifluorophenyl)butyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC(Cc1cc(F)c(F)cc1F)C(Cc1nc(C(F)(F)F)ccc1C(=O)NC(C)(C)C)N=O |
| InChI | InChI=1S/C22H23F6N3O2/c1-11(7-12-8-15(24)16(25)9-14(12)23)17(31-33)10-18-13(20(32)30-21(2,3)4)5-6-19(29-18)22(26,27)28/h5-6,8-9,11,17H,7,10H2,1-4H3,(H,30,32) |
| InChIKey | AGOODHVLEFLRLG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|