About N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride
N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride (PubChem CID 91547626) has the molecular formula C16H31ClN2O3Si
and a molecular weight of 362.97 g/mol. Its IUPAC name is N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride.
Molecular Properties
| Compound Name | N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride |
| PubChem CID | 91547626 |
| Molecular Formula | C16H31ClN2O3Si |
| Molecular Weight | 362.97 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride |
| SMILES | C=Cc1ccccc1.CCNCCNC[Si](OC)(OC)OC.Cl |
| InChI | InChI=1S/C8H22N2O3Si.C8H8.ClH/c1-5-9-6-7-10-8-14(11-2,12-3)13-4;1-2-8-6-4-3-5-7-8;/h9-10H,5-8H2,1-4H3;2-7H,1H2;1H |
| InChIKey | WPUNUDQNIBWZMX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.97 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride?
The IUPAC name of N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride (CID 91547626) is N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride.
What is the SMILES notation for N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride?
The canonical SMILES for N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride is C=Cc1ccccc1.CCNCCNC[Si](OC)(OC)OC.Cl.
What is the InChIKey of N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride?
The InChIKey is WPUNUDQNIBWZMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H22N2O3Si.C8H8.ClH/c1-5-9-6-7-10-8-14(11-2,12-3)13-4;1-2-8-6-4-3-5-7-8;/h9-10H,5-8H2,1-4H3;2-7H,1H2;1H.
What are the key properties of N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride?
N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride has a molecular weight of 362.97 g/mol, XLogP of 2.35, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(trimethoxysilylmethyl)ethane-1,2-diamine;styrene;hydrochloride is sourced from PubChem (CID 91547626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).