About hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium
hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium (PubChem CID 91547687) has the molecular formula C20H42O4P+
and a molecular weight of 377.53 g/mol. Its IUPAC name is hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium.
Molecular Properties
| Compound Name | hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium |
| PubChem CID | 91547687 |
| Molecular Formula | C20H42O4P+ |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium |
| SMILES | CCC(C)COCC(C)(CC)COCC(C)(C)CC(C)(CC)[P+](=O)O |
| InChI | InChI=1S/C20H41O4P/c1-9-17(4)12-23-15-19(7,10-2)16-24-14-18(5,6)13-20(8,11-3)25(21)22/h17H,9-16H2,1-8H3/p+1 |
| InChIKey | YGFFGPDLKWWBPM-UHFFFAOYSA-O |
| XLogP | 5.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium?
The IUPAC name of hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium (CID 91547687) is hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium.
What is the SMILES notation for hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium?
The canonical SMILES for hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium is CCC(C)COCC(C)(CC)COCC(C)(C)CC(C)(CC)[P+](=O)O.
What is the InChIKey of hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium?
The InChIKey is YGFFGPDLKWWBPM-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H41O4P/c1-9-17(4)12-23-15-19(7,10-2)16-24-14-18(5,6)13-20(8,11-3)25(21)22/h17H,9-16H2,1-8H3/p+1.
What are the key properties of hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium?
hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium has a molecular weight of 377.53 g/mol, XLogP of 5.80, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-[3,5,5-trimethyl-6-[2-methyl-2-(2-methylbutoxymethyl)butoxy]hexan-3-yl]phosphanium is sourced from PubChem (CID 91547687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).