C24H27N3O — CID 91547953
3-[[4-[diazenyl(phenyl)methyl]phenyl]methoxy]-N,N-diethylaniline (PubChem CID 91547953) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-[[4-[diazenyl(phenyl)methyl]phenyl]methoxy]-N,N-diethylaniline.
| Compound Name | 3-[[4-[diazenyl(phenyl)methyl]phenyl]methoxy]-N,N-diethylaniline |
|---|---|
| PubChem CID | 91547953 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 3-[[4-[diazenyl(phenyl)methyl]phenyl]methoxy]-N,N-diethylaniline |
| SMILES | [H]/N=N/C(c1ccccc1)c1ccc(COc2cccc(N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C24H27N3O/c1-3-27(4-2)22-11-8-12-23(17-22)28-18-19-13-15-21(16-14-19)24(26-25)20-9-6-5-7-10-20/h5-17,24-25H,3-4,18H2,1-2H3/b26-25+ |
| InChIKey | MHPNQNVDXJUNGX-OCEACIFDSA-N |
| XLogP | 6.23 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|