C18H19N5O — CID 91548223
5-[[[(Z)-hex-4-en-3-ylidene]amino]methyl]-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 91548223) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-[[[(Z)-hex-4-en-3-ylidene]amino]methyl]-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[[[(Z)-hex-4-en-3-ylidene]amino]methyl]-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 91548223 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 5-[[[(Z)-hex-4-en-3-ylidene]amino]methyl]-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | C/C=C\C(CC)=N\Cc1cc(=O)n2[nH]c(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C18H19N5O/c1-3-8-14(4-2)19-12-15-11-16(24)23-18(20-15)21-17(22-23)13-9-6-5-7-10-13/h3,5-11H,4,12H2,1-2H3,(H,20,21,22)/b8-3-,19-14+ |
| InChIKey | XYXYFGJXJBQSMK-IALMSTKYSA-N |
| XLogP | 3.01 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|