About 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine
3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine (PubChem CID 91548272) has the molecular formula C14H21ClN2
and a molecular weight of 252.79 g/mol. Its IUPAC name is 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine.
Molecular Properties
| Compound Name | 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine |
| PubChem CID | 91548272 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine |
| SMILES | CC1CCN(C2=CCC(C)C(Cl)=C/N=C\2)CC1 |
| InChI | InChI=1S/C14H21ClN2/c1-11-5-7-17(8-6-11)13-4-3-12(2)14(15)10-16-9-13/h4,9-12H,3,5-8H2,1-2H3/b13-4?,14-10?,16-9- |
| InChIKey | YHTOHUCKXMSZFW-VPYKUGOSSA-N |
| XLogP | 3.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine?
The IUPAC name of 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine (CID 91548272) is 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine.
What is the SMILES notation for 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine?
The canonical SMILES for 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine is CC1CCN(C2=CCC(C)C(Cl)=C/N=C\2)CC1.
What is the InChIKey of 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine?
The InChIKey is YHTOHUCKXMSZFW-VPYKUGOSSA-N. The full InChI is InChI=1S/C14H21ClN2/c1-11-5-7-17(8-6-11)13-4-3-12(2)14(15)10-16-9-13/h4,9-12H,3,5-8H2,1-2H3/b13-4?,14-10?,16-9-.
What are the key properties of 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine?
3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine has a molecular weight of 252.79 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-methyl-7-(4-methylpiperidin-1-yl)-4,5-dihydroazocine is sourced from PubChem (CID 91548272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).