C24H23ClN4O4S — CID 91548665
[2-[2-amino-4-(2,6-dimethyl-4-pyridinyl)-1-methyl-5-oxoimidazol-4-yl]-5-chloro-3-phenylphenyl] methanesulfonate (PubChem CID 91548665) has the molecular formula C24H23ClN4O4S and a molecular weight of 498.99 g/mol. Its IUPAC name is [2-[2-amino-4-(2,6-dimethyl-4-pyridinyl)-1-methyl-5-oxoimidazol-4-yl]-5-chloro-3-phenylphenyl] methanesulfonate.
| Compound Name | [2-[2-amino-4-(2,6-dimethyl-4-pyridinyl)-1-methyl-5-oxoimidazol-4-yl]-5-chloro-3-phenylphenyl] methanesulfonate |
|---|---|
| PubChem CID | 91548665 |
| Molecular Formula | C24H23ClN4O4S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [2-[2-amino-4-(2,6-dimethyl-4-pyridinyl)-1-methyl-5-oxoimidazol-4-yl]-5-chloro-3-phenylphenyl] methanesulfonate |
| SMILES | Cc1cc(C2(c3c(OS(C)(=O)=O)cc(Cl)cc3-c3ccccc3)N=C(N)N(C)C2=O)cc(C)n1 |
| InChI | InChI=1S/C24H23ClN4O4S/c1-14-10-17(11-15(2)27-14)24(22(30)29(3)23(26)28-24)21-19(16-8-6-5-7-9-16)12-18(25)13-20(21)33-34(4,31)32/h5-13H,1-4H3,(H2,26,28) |
| InChIKey | OJYBOIHIBJSKEF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|