C11H11NO2 — CID 91548731
3-(3-methylphenyl)-1H-pyrrole-2,5-diol (PubChem CID 91548731) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1H-pyrrole-2,5-diol.
| Compound Name | 3-(3-methylphenyl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91548731 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3-(3-methylphenyl)-1H-pyrrole-2,5-diol |
| SMILES | Cc1cccc(-c2cc(O)[nH]c2O)c1 |
| InChI | InChI=1S/C11H11NO2/c1-7-3-2-4-8(5-7)9-6-10(13)12-11(9)14/h2-6,12-14H,1H3 |
| InChIKey | PHFLLIUDNCLZDZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |