C21H23N3O3 — CID 91548740
(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-benzylcarbamate (PubChem CID 91548740) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-benzylcarbamate.
| Compound Name | (3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-benzylcarbamate |
|---|---|
| PubChem CID | 91548740 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)ON1CCC2(C=C(c3ccccc3)NO2)CC1 |
| InChI | InChI=1S/C21H23N3O3/c25-20(22-16-17-7-3-1-4-8-17)26-24-13-11-21(12-14-24)15-19(23-27-21)18-9-5-2-6-10-18/h1-10,15,23H,11-14,16H2,(H,22,25) |
| InChIKey | SUCNFFXQFRDRDB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |