C21H38N2O — CID 91548989
2-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)morpholin-3-yl]ethanamine (PubChem CID 91548989) has the molecular formula C21H38N2O and a molecular weight of 334.55 g/mol. Its IUPAC name is 2-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)morpholin-3-yl]ethanamine.
| Compound Name | 2-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)morpholin-3-yl]ethanamine |
|---|---|
| PubChem CID | 91548989 |
| Molecular Formula | C21H38N2O |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.30 |
| IUPAC Name | 2-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)morpholin-3-yl]ethanamine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN1CCOCC1CCN |
| InChI | InChI=1S/C21H38N2O/c1-18(2)7-5-8-19(3)9-6-10-20(4)12-14-23-15-16-24-17-21(23)11-13-22/h7,9,12,21H,5-6,8,10-11,13-17,22H2,1-4H3 |
| InChIKey | YPIDPXJFARZBMI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|