C12H14BrN2S+ — CID 915490
(1S)-1-(bromomethyl)-1,4-dimethyl-2H-[1,3]thiazolo[3,2-a]benzimidazol-4-ium (PubChem CID 915490) has the molecular formula C12H14BrN2S+ and a molecular weight of 298.23 g/mol. Its IUPAC name is (1S)-1-(bromomethyl)-1,4-dimethyl-2H-[1,3]thiazolo[3,2-a]benzimidazol-4-ium.
| Compound Name | (1S)-1-(bromomethyl)-1,4-dimethyl-2H-[1,3]thiazolo[3,2-a]benzimidazol-4-ium |
|---|---|
| PubChem CID | 915490 |
| Molecular Formula | C12H14BrN2S+ |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | (1S)-1-(bromomethyl)-1,4-dimethyl-2H-[1,3]thiazolo[3,2-a]benzimidazol-4-ium |
| SMILES | C[n+]1c2n(c3ccccc31)[C@](C)(CBr)CS2 |
| InChI | InChI=1S/C12H14BrN2S/c1-12(7-13)8-16-11-14(2)9-5-3-4-6-10(9)15(11)12/h3-6H,7-8H2,1-2H3/q+1/t12-/m1/s1 |
| InChIKey | RBZADCNKICBMNV-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|