C31H36N2O2S — CID 91549202
5-[6-(2,2-dimethylpropyl)-1,3-benzothiazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 91549202) has the molecular formula C31H36N2O2S and a molecular weight of 500.71 g/mol. Its IUPAC name is 5-[6-(2,2-dimethylpropyl)-1,3-benzothiazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-[6-(2,2-dimethylpropyl)-1,3-benzothiazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 91549202 |
| Molecular Formula | C31H36N2O2S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 5-[6-(2,2-dimethylpropyl)-1,3-benzothiazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC(C)(C)Cc1ccc2nc(-c3cc4cc5c6c(c4oc3=O)C(C)(C)CCN6CCC5(C)C)sc2c1 |
| InChI | InChI=1S/C31H36N2O2S/c1-29(2,3)17-18-8-9-22-23(14-18)36-27(32-22)20-15-19-16-21-25-24(26(19)35-28(20)34)31(6,7)11-13-33(25)12-10-30(21,4)5/h8-9,14-16H,10-13,17H2,1-7H3 |
| InChIKey | QMBVYUANSDADOG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|