About [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol
[3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 91550052) has the molecular formula C8H8BrNO2S
and a molecular weight of 262.13 g/mol. Its IUPAC name is [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
| PubChem CID | 91550052 |
| Molecular Formula | C8H8BrNO2S |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OCC1C=C(c2ccc(Br)s2)NO1 |
| InChI | InChI=1S/C8H8BrNO2S/c9-8-2-1-7(13-8)6-3-5(4-11)12-10-6/h1-3,5,10-11H,4H2 |
| InChIKey | PUVGFPDEQKPJAH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
The IUPAC name of [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol (CID 91550052) is [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol is OCC1C=C(c2ccc(Br)s2)NO1.
What is the InChIKey of [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
The InChIKey is PUVGFPDEQKPJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2S/c9-8-2-1-7(13-8)6-3-5(4-11)12-10-6/h1-3,5,10-11H,4H2.
What are the key properties of [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol?
[3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol has a molecular weight of 262.13 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-bromothiophen-2-yl)-2,5-dihydro-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 91550052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).