C30H35F3O4SSi — CID 91550496
[4-[1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenylpent-1-enyl]phenyl] trifluoromethanesulfonate (PubChem CID 91550496) has the molecular formula C30H35F3O4SSi and a molecular weight of 576.75 g/mol. Its IUPAC name is [4-[1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenylpent-1-enyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenylpent-1-enyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91550496 |
| Molecular Formula | C30H35F3O4SSi |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | [4-[1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenylpent-1-enyl]phenyl] trifluoromethanesulfonate |
| SMILES | CCCC(=C(c1ccc(O[Si](C)(C)C(C)(C)C)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H35F3O4SSi/c1-7-11-27(22-12-9-8-10-13-22)28(23-14-18-25(19-15-23)36-38(34,35)30(31,32)33)24-16-20-26(21-17-24)37-39(5,6)29(2,3)4/h8-10,12-21H,7,11H2,1-6H3 |
| InChIKey | WJSMEJVXOUJSBZ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|