C11H22O3P2 — CID 91550555
(2R,3S,4S)-2-[(3S,4S)-3-hydroxy-1,4-dimethylphospholan-2-yl]-1-methylphospholane-3,4-diol (PubChem CID 91550555) has the molecular formula C11H22O3P2 and a molecular weight of 264.24 g/mol. Its IUPAC name is (2R,3S,4S)-2-[(3S,4S)-3-hydroxy-1,4-dimethylphospholan-2-yl]-1-methylphospholane-3,4-diol.
| Compound Name | (2R,3S,4S)-2-[(3S,4S)-3-hydroxy-1,4-dimethylphospholan-2-yl]-1-methylphospholane-3,4-diol |
|---|---|
| PubChem CID | 91550555 |
| Molecular Formula | C11H22O3P2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2R,3S,4S)-2-[(3S,4S)-3-hydroxy-1,4-dimethylphospholan-2-yl]-1-methylphospholane-3,4-diol |
| SMILES | C[C@@H]1CP(C)C(C2[C@@H](O)[C@H](O)CP2C)[C@H]1O |
| InChI | InChI=1S/C11H22O3P2/c1-6-4-15(2)10(8(6)13)11-9(14)7(12)5-16(11)3/h6-14H,4-5H2,1-3H3/t6-,7-,8+,9+,10?,11?,15?,16?/m1/s1 |
| InChIKey | DOGGPRUMOAVTPY-WOQFRGIUSA-N |
| XLogP | 0.69 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|