C10H14N2O2 — CID 91550570
(6S,8aS)-6-prop-1-enyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 91550570) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (6S,8aS)-6-prop-1-enyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (6S,8aS)-6-prop-1-enyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 91550570 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (6S,8aS)-6-prop-1-enyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC=C[C@@H]1CC[C@H]2C(=O)NCC(=O)N12 |
| InChI | InChI=1S/C10H14N2O2/c1-2-3-7-4-5-8-10(14)11-6-9(13)12(7)8/h2-3,7-8H,4-6H2,1H3,(H,11,14)/t7-,8+/m1/s1 |
| InChIKey | UXGVHJZMGZHUFD-SFYZADRCSA-N |
| XLogP | 0.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|