About 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid
2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid (PubChem CID 91550656) has the molecular formula C5H6N2O3
and a molecular weight of 142.11 g/mol. Its IUPAC name is 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid |
| PubChem CID | 91550656 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C1N=CC(C(=O)O)CN1 |
| InChI | InChI=1S/C5H6N2O3/c8-4(9)3-1-6-5(10)7-2-3/h1,3H,2H2,(H,7,10)(H,8,9) |
| InChIKey | MDTFLCSHVSEEKK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid (CID 91550656) is 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid is O=C1N=CC(C(=O)O)CN1.
What is the InChIKey of 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid?
The InChIKey is MDTFLCSHVSEEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c8-4(9)3-1-6-5(10)7-2-3/h1,3H,2H2,(H,7,10)(H,8,9).
What are the key properties of 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid?
2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid has a molecular weight of 142.11 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 91550656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).