C17H30F3N7 — CID 91550942
2-N,4-N,6-N,6-N-tetramethyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(trifluoromethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 91550942) has the molecular formula C17H30F3N7 and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-N,4-N,6-N,6-N-tetramethyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(trifluoromethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N,6-N-tetramethyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(trifluoromethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 91550942 |
| Molecular Formula | C17H30F3N7 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 2-N,4-N,6-N,6-N-tetramethyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(trifluoromethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N(C)C2CC(C)(C)NC(C)(C)C2)nc(N(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C17H30F3N7/c1-15(2)9-11(10-16(3,4)24-15)26(7)13-21-12(25(5)6)22-14(23-13)27(8)17(18,19)20/h11,24H,9-10H2,1-8H3 |
| InChIKey | VYWWGAFODNWVIZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|