About 5,6-dihydrotetrazolo[1,5-a]pyridine
5,6-dihydrotetrazolo[1,5-a]pyridine (PubChem CID 91551042) has the molecular formula C5H6N4
and a molecular weight of 122.13 g/mol. Its IUPAC name is 5,6-dihydrotetrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 5,6-dihydrotetrazolo[1,5-a]pyridine |
| PubChem CID | 91551042 |
| Molecular Formula | C5H6N4 |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 5,6-dihydrotetrazolo[1,5-a]pyridine |
| SMILES | C1=Cc2nnnn2CC1 |
| InChI | InChI=1S/C5H6N4/c1-2-4-9-5(3-1)6-7-8-9/h1,3H,2,4H2 |
| InChIKey | BABYDLSHHBPMGJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dihydrotetrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrotetrazolo[1,5-a]pyridine?
The IUPAC name of 5,6-dihydrotetrazolo[1,5-a]pyridine (CID 91551042) is 5,6-dihydrotetrazolo[1,5-a]pyridine.
What is the SMILES notation for 5,6-dihydrotetrazolo[1,5-a]pyridine?
The canonical SMILES for 5,6-dihydrotetrazolo[1,5-a]pyridine is C1=Cc2nnnn2CC1.
What is the InChIKey of 5,6-dihydrotetrazolo[1,5-a]pyridine?
The InChIKey is BABYDLSHHBPMGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4/c1-2-4-9-5(3-1)6-7-8-9/h1,3H,2,4H2.
What are the key properties of 5,6-dihydrotetrazolo[1,5-a]pyridine?
5,6-dihydrotetrazolo[1,5-a]pyridine has a molecular weight of 122.13 g/mol, XLogP of 0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrotetrazolo[1,5-a]pyridine is sourced from PubChem (CID 91551042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).