C24H48O5Si — CID 91551569
tert-butyl (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3,4,4,6,8-pentamethyl-5-oxononanoate (PubChem CID 91551569) has the molecular formula C24H48O5Si and a molecular weight of 444.73 g/mol. Its IUPAC name is tert-butyl (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3,4,4,6,8-pentamethyl-5-oxononanoate.
| Compound Name | tert-butyl (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3,4,4,6,8-pentamethyl-5-oxononanoate |
|---|---|
| PubChem CID | 91551569 |
| Molecular Formula | C24H48O5Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | tert-butyl (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3,4,4,6,8-pentamethyl-5-oxononanoate |
| SMILES | C[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H48O5Si/c1-16(15-25)20(29-30(12,13)23(7,8)9)18(3)21(27)24(10,11)17(2)14-19(26)28-22(4,5)6/h16-18,20,25H,14-15H2,1-13H3/t16-,17-,18+,20-/m0/s1 |
| InChIKey | IIJPDOWWRVYPPW-GNBUJSLZSA-N |
| XLogP | 5.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|