C29H33F3N4O4 — CID 91551668
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-methyl-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 91551668) has the molecular formula C29H33F3N4O4 and a molecular weight of 558.60 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-methyl-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-methyl-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91551668 |
| Molecular Formula | C29H33F3N4O4 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-methyl-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(CCc4cc(C)c(O)c(CC(F)(F)F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C29H33F3N4O4/c1-16-10-19(12-20(25(16)38)14-29(30,31)32)8-9-28(21-6-4-5-7-21)15-23(37)22(26(39)40-28)13-24-34-27-33-17(2)11-18(3)36(27)35-24/h10-12,21-22,38H,4-9,13-15H2,1-3H3 |
| InChIKey | GPCXAJCGSSPMMD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|