C20H22F3N7 — CID 91551689
(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide (PubChem CID 91551689) has the molecular formula C20H22F3N7 and a molecular weight of 417.44 g/mol. Its IUPAC name is (2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide.
| Compound Name | (2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 91551689 |
| Molecular Formula | C20H22F3N7 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(N)=N/c4cccc(C(F)(F)F)c4)[C@@H](C)C3)c12 |
| InChI | InChI=1S/C20H22F3N7/c1-12-9-25-17-16(12)18(27-11-26-17)29-6-7-30(13(2)10-29)19(24)28-15-5-3-4-14(8-15)20(21,22)23/h3-5,8-9,11,13H,6-7,10H2,1-2H3,(H2,24,28)(H,25,26,27)/t13-/m0/s1 |
| InChIKey | FUAPRDPNFTUVLL-ZDUSSCGKSA-N |
| XLogP | 3.44 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|