C11H21N — CID 91551966
3-pentan-3-ylhexa-3,5-dien-1-amine (PubChem CID 91551966) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 3-pentan-3-ylhexa-3,5-dien-1-amine.
| Compound Name | 3-pentan-3-ylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 91551966 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3-pentan-3-ylhexa-3,5-dien-1-amine |
| SMILES | C=CC=C(CCN)C(CC)CC |
| InChI | InChI=1S/C11H21N/c1-4-7-11(8-9-12)10(5-2)6-3/h4,7,10H,1,5-6,8-9,12H2,2-3H3 |
| InChIKey | OKBFLMQJJKNPOD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|