About 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one
2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one (PubChem CID 91552088) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one |
| PubChem CID | 91552088 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one |
| SMILES | CC(O)C(C)(O)CCCCCC1C=CC(=O)O1 |
| InChI | InChI=1S/C13H22O4/c1-10(14)13(2,16)9-5-3-4-6-11-7-8-12(15)17-11/h7-8,10-11,14,16H,3-6,9H2,1-2H3 |
| InChIKey | QLCNGDGKEPRQMG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one?
The IUPAC name of 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one (CID 91552088) is 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one.
What is the SMILES notation for 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one?
The canonical SMILES for 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one is CC(O)C(C)(O)CCCCCC1C=CC(=O)O1.
What is the InChIKey of 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one?
The InChIKey is QLCNGDGKEPRQMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-10(14)13(2,16)9-5-3-4-6-11-7-8-12(15)17-11/h7-8,10-11,14,16H,3-6,9H2,1-2H3.
What are the key properties of 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one?
2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one has a molecular weight of 242.31 g/mol, XLogP of 1.55, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydroxy-6-methyloctyl)-2H-furan-5-one is sourced from PubChem (CID 91552088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).