C6H14N2O4 — CID 91552179
(2S,4R,5S,6R)-6-(diaminomethyl)oxane-2,4,5-triol (PubChem CID 91552179) has the molecular formula C6H14N2O4 and a molecular weight of 178.19 g/mol. Its IUPAC name is (2S,4R,5S,6R)-6-(diaminomethyl)oxane-2,4,5-triol.
| Compound Name | (2S,4R,5S,6R)-6-(diaminomethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 91552179 |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2S,4R,5S,6R)-6-(diaminomethyl)oxane-2,4,5-triol |
| SMILES | NC(N)[C@H]1O[C@H](O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14N2O4/c7-6(8)5-4(11)2(9)1-3(10)12-5/h2-6,9-11H,1,7-8H2/t2-,3+,4+,5+/m1/s1 |
| InChIKey | ZCIGHFLNQKICMT-STGXQOJASA-N |
| XLogP | -2.94 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|