C16H24O5S — CID 91552257
methyl 6-(2-ethylsulfanylpropyl)-2,4-dioxo-3-propanoylcyclohexane-1-carboxylate (PubChem CID 91552257) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is methyl 6-(2-ethylsulfanylpropyl)-2,4-dioxo-3-propanoylcyclohexane-1-carboxylate.
| Compound Name | methyl 6-(2-ethylsulfanylpropyl)-2,4-dioxo-3-propanoylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91552257 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | methyl 6-(2-ethylsulfanylpropyl)-2,4-dioxo-3-propanoylcyclohexane-1-carboxylate |
| SMILES | CCSC(C)CC1CC(=O)C(C(=O)CC)C(=O)C1C(=O)OC |
| InChI | InChI=1S/C16H24O5S/c1-5-11(17)14-12(18)8-10(7-9(3)22-6-2)13(15(14)19)16(20)21-4/h9-10,13-14H,5-8H2,1-4H3 |
| InChIKey | RJHWSEHOHWAMPA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|