C22H8F8N2 — CID 91552480
4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pyridin-4-ylphenyl)phenyl]pyridine (PubChem CID 91552480) has the molecular formula C22H8F8N2 and a molecular weight of 452.30 g/mol. Its IUPAC name is 4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pyridin-4-ylphenyl)phenyl]pyridine.
| Compound Name | 4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pyridin-4-ylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 91552480 |
| Molecular Formula | C22H8F8N2 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pyridin-4-ylphenyl)phenyl]pyridine |
| SMILES | Fc1c(F)c(-c2c(F)c(F)c(-c3ccncc3)c(F)c2F)c(F)c(F)c1-c1ccncc1 |
| InChI | InChI=1S/C22H8F8N2/c23-15-11(9-1-5-31-6-2-9)16(24)20(28)13(19(15)27)14-21(29)17(25)12(18(26)22(14)30)10-3-7-32-8-4-10/h1-8H |
| InChIKey | XXMYTEQSJGWCRY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|