C68H60N8 — CID 91553466
5,15-bis[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91553466) has the molecular formula C68H60N8 and a molecular weight of 989.28 g/mol. Its IUPAC name is 5,15-bis[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,15-bis[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91553466 |
| Molecular Formula | C68H60N8 |
| Molecular Weight | 989.28 g/mol |
| Exact Mass | 988.49 |
| IUPAC Name | 5,15-bis[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Cc1cc(C)c(C2=c3ccc([nH]3)=C(c3ccc(C(c4ccc[nH]4)c4ccc[nH]4)cc3)c3ccc([nH]3)C(c3c(C)cc(C)cc3C)=c3ccc([nH]3)=C(c3ccc(C(c4ccc[nH]4)c4ccc[nH]4)cc3)c3ccc2[nH]3)c(C)c1 |
| InChI | InChI=1S/C68H60N8/c1-39-35-41(3)61(42(4)36-39)67-57-27-23-53(73-57)65(47-19-15-45(16-20-47)63(49-11-7-31-69-49)50-12-8-32-70-50)55-25-29-59(75-55)68(62-43(5)37-40(2)38-44(62)6)60-30-26-56(76-60)66(54-24-28-58(67)74-54)48-21-17-46(18-22-48)64(51-13-9-33-71-51)52-14-10-34-72-52/h7-38,63-64,69-76H,1-6H3 |
| InChIKey | LJPXGZRQVDDPME-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.28 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 0 |