C10H7F5O — CID 91553532
1,2,3,4,5-pentafluoro-6-(prop-1-enoxymethyl)benzene (PubChem CID 91553532) has the molecular formula C10H7F5O and a molecular weight of 238.15 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(prop-1-enoxymethyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(prop-1-enoxymethyl)benzene |
|---|---|
| PubChem CID | 91553532 |
| Molecular Formula | C10H7F5O |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(prop-1-enoxymethyl)benzene |
| SMILES | CC=COCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7F5O/c1-2-3-16-4-5-6(11)8(13)10(15)9(14)7(5)12/h2-3H,4H2,1H3 |
| InChIKey | PPBJNWWUVDMWER-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|