C21H23N3O4S — CID 9155420
(5S)-5-ethyl-N'-[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 9155420) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is (5S)-5-ethyl-N'-[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5S)-5-ethyl-N'-[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9155420 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (5S)-5-ethyl-N'-[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | CC[C@H]1CCc2sc(C(=O)NNC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc2C1 |
| InChI | InChI=1S/C21H23N3O4S/c1-2-12-7-8-17-13(9-12)10-18(29-17)21(27)24-23-19(25)11-16-20(26)22-14-5-3-4-6-15(14)28-16/h3-6,10,12,16H,2,7-9,11H2,1H3,(H,22,26)(H,23,25)(H,24,27)/t12-,16-/m0/s1 |
| InChIKey | SPOLBNBFZGUNID-LRDDRELGSA-N |
| XLogP | 2.81 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|