C19H17N3O3S2 — CID 9155437
2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]acetamide (PubChem CID 9155437) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]acetamide.
| Compound Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9155437 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN1c2cccc3cccc(c23)S1(=O)=O)c1ccc(C)s1 |
| InChI | InChI=1S/C19H17N3O3S2/c1-12-9-10-16(26-12)13(2)20-21-18(23)11-22-15-7-3-5-14-6-4-8-17(19(14)15)27(22,24)25/h3-10H,11H2,1-2H3,(H,21,23)/b20-13- |
| InChIKey | BCZRWMGLGOQDHW-MOSHPQCFSA-N |
| XLogP | 3.26 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|