C18H25N5O2S — CID 9155450
N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 9155450) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 9155450 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2csc(N3CCOCC3)n2)c(C)n1C(C)C |
| InChI | InChI=1S/C18H25N5O2S/c1-12(2)23-13(3)9-15(14(23)4)10-19-21-17(24)16-11-26-18(20-16)22-5-7-25-8-6-22/h9-12H,5-8H2,1-4H3,(H,21,24)/b19-10- |
| InChIKey | ZCLRDUDXEQVAFF-GRSHGNNSSA-N |
| XLogP | 2.74 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|