C4H3F8P — CID 91555049
difluoro-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)phosphane (PubChem CID 91555049) has the molecular formula C4H3F8P and a molecular weight of 234.03 g/mol. Its IUPAC name is difluoro-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)phosphane.
| Compound Name | difluoro-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)phosphane |
|---|---|
| PubChem CID | 91555049 |
| Molecular Formula | C4H3F8P |
| Molecular Weight | 234.03 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | difluoro-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)phosphane |
| SMILES | CC(F)(C(F)(F)F)C(F)(F)P(F)F |
| InChI | InChI=1S/C4H3F8P/c1-2(5,3(6,7)8)4(9,10)13(11)12/h1H3 |
| InChIKey | AFLNBOYJMJXNPS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|