C22H38O6 — CID 91555110
dibutyl 2-[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]oxypropanedioate (PubChem CID 91555110) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is dibutyl 2-[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]oxypropanedioate.
| Compound Name | dibutyl 2-[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]oxypropanedioate |
|---|---|
| PubChem CID | 91555110 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | dibutyl 2-[1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropanecarbonyl]oxypropanedioate |
| SMILES | CCCCOC(=O)C(OC(=O)C1(CC(C)(C)C)CC1(C)C)C(=O)OCCCC |
| InChI | InChI=1S/C22H38O6/c1-8-10-12-26-17(23)16(18(24)27-13-11-9-2)28-19(25)22(14-20(3,4)5)15-21(22,6)7/h16H,8-15H2,1-7H3 |
| InChIKey | LTAOXSZDESUJKH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|