C17H16ClN3O4 — CID 91555791
3-chloro-5-[(1R,2S,4R,5S,8S,12R)-2-hydroxy-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]pyridine-2-carbonitrile (PubChem CID 91555791) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is 3-chloro-5-[(1R,2S,4R,5S,8S,12R)-2-hydroxy-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-5-[(1R,2S,4R,5S,8S,12R)-2-hydroxy-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 91555791 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 3-chloro-5-[(1R,2S,4R,5S,8S,12R)-2-hydroxy-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]pyridine-2-carbonitrile |
| SMILES | C[C@@]12C[C@H](O)[C@]3(CCO[C@H]4[C@@H]3[C@@H]1C(=O)N4c1cnc(C#N)c(Cl)c1)O2 |
| InChI | InChI=1S/C17H16ClN3O4/c1-16-5-11(22)17(25-16)2-3-24-15-13(17)12(16)14(23)21(15)8-4-9(18)10(6-19)20-7-8/h4,7,11-13,15,22H,2-3,5H2,1H3/t11-,12+,13-,15-,16+,17-/m0/s1 |
| InChIKey | JUJJRBZXHBROSP-YMWMKHGGSA-N |
| XLogP | 1.22 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |