C48H39Cl2N3O5 — CID 91555841
7-benzoyl-N-[1-[4-(4-cyanophenyl)phenyl]propan-2-yl]-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide (PubChem CID 91555841) has the molecular formula C48H39Cl2N3O5 and a molecular weight of 808.76 g/mol. Its IUPAC name is 7-benzoyl-N-[1-[4-(4-cyanophenyl)phenyl]propan-2-yl]-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide.
| Compound Name | 7-benzoyl-N-[1-[4-(4-cyanophenyl)phenyl]propan-2-yl]-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 91555841 |
| Molecular Formula | C48H39Cl2N3O5 |
| Molecular Weight | 808.76 g/mol |
| Exact Mass | 807.23 |
| IUPAC Name | 7-benzoyl-N-[1-[4-(4-cyanophenyl)phenyl]propan-2-yl]-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide |
| SMILES | CC(Cc1ccc(-c2ccc(C#N)cc2)cc1)NC(=O)C1Cc2cc3c(cc2CN1C(=O)c1ccccc1)OC(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)CO3 |
| InChI | InChI=1S/C48H39Cl2N3O5/c1-30(21-31-7-12-34(13-8-31)35-14-9-32(26-51)10-15-35)52-47(54)43-23-38-24-44-45(25-39(38)27-53(43)48(55)37-5-3-2-4-6-37)58-46(29-57-44)36-16-18-40(19-17-36)56-28-33-11-20-41(49)42(50)22-33/h2-20,22,24-25,30,43,46H,21,23,27-29H2,1H3,(H,52,54) |
| InChIKey | RLGMBCDDJFYMOA-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.76 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |