C20H24F2N2O2S — CID 91555948
[3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-ethylphenyl)methyl]carbamothioic S-acid (PubChem CID 91555948) has the molecular formula C20H24F2N2O2S and a molecular weight of 394.49 g/mol. Its IUPAC name is [3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-ethylphenyl)methyl]carbamothioic S-acid.
| Compound Name | [3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-ethylphenyl)methyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 91555948 |
| Molecular Formula | C20H24F2N2O2S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-ethylphenyl)methyl]carbamothioic S-acid |
| SMILES | CCc1cccc(CN(CC(O)C(N)Cc2cc(F)cc(F)c2)C(=O)S)c1 |
| InChI | InChI=1S/C20H24F2N2O2S/c1-2-13-4-3-5-14(6-13)11-24(20(26)27)12-19(25)18(23)9-15-7-16(21)10-17(22)8-15/h3-8,10,18-19,25H,2,9,11-12,23H2,1H3,(H,26,27) |
| InChIKey | UESADVOSAQKOPS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|