C27H27F3N4O3 — CID 91556267
5,5-dimethyl-1-[piperidin-3-yl(quinolin-4-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 91556267) has the molecular formula C27H27F3N4O3 and a molecular weight of 512.53 g/mol. Its IUPAC name is 5,5-dimethyl-1-[piperidin-3-yl(quinolin-4-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1-[piperidin-3-yl(quinolin-4-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91556267 |
| Molecular Formula | C27H27F3N4O3 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 5,5-dimethyl-1-[piperidin-3-yl(quinolin-4-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc(OC(F)(F)F)cc2)C(=O)N1C(c1ccnc2ccccc12)C1CCCNC1 |
| InChI | InChI=1S/C27H27F3N4O3/c1-26(2)24(35)33(18-9-11-19(12-10-18)37-27(28,29)30)25(36)34(26)23(17-6-5-14-31-16-17)21-13-15-32-22-8-4-3-7-20(21)22/h3-4,7-13,15,17,23,31H,5-6,14,16H2,1-2H3 |
| InChIKey | JXABKYWGEOMELE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|