About 2-methoxy-N,N-dimethylethenamine
2-methoxy-N,N-dimethylethenamine (PubChem CID 91556272) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 2-methoxy-N,N-dimethylethenamine |
| PubChem CID | 91556272 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | 2-methoxy-N,N-dimethylethenamine |
| SMILES | COC=CN(C)C |
| InChI | InChI=1S/C5H11NO/c1-6(2)4-5-7-3/h4-5H,1-3H3 |
| InChIKey | ZBFSCAJKIIHPBS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,N-dimethylethenamine?
The IUPAC name of 2-methoxy-N,N-dimethylethenamine (CID 91556272) is 2-methoxy-N,N-dimethylethenamine.
What is the SMILES notation for 2-methoxy-N,N-dimethylethenamine?
The canonical SMILES for 2-methoxy-N,N-dimethylethenamine is COC=CN(C)C.
What is the InChIKey of 2-methoxy-N,N-dimethylethenamine?
The InChIKey is ZBFSCAJKIIHPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO/c1-6(2)4-5-7-3/h4-5H,1-3H3.
What are the key properties of 2-methoxy-N,N-dimethylethenamine?
2-methoxy-N,N-dimethylethenamine has a molecular weight of 101.15 g/mol, XLogP of 0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,N-dimethylethenamine is sourced from PubChem (CID 91556272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).