C19H24F3NO3S — CID 91556553
S-[(3R,5S)-1-(3-methylbutanoyl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-3-yl] ethanethioate (PubChem CID 91556553) has the molecular formula C19H24F3NO3S and a molecular weight of 403.47 g/mol. Its IUPAC name is S-[(3R,5S)-1-(3-methylbutanoyl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[(3R,5S)-1-(3-methylbutanoyl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 91556553 |
| Molecular Formula | C19H24F3NO3S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | S-[(3R,5S)-1-(3-methylbutanoyl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1C[C@@H](COCc2cc(F)c(F)cc2F)N(C(=O)CC(C)C)C1 |
| InChI | InChI=1S/C19H24F3NO3S/c1-11(2)4-19(25)23-8-15(27-12(3)24)6-14(23)10-26-9-13-5-17(21)18(22)7-16(13)20/h5,7,11,14-15H,4,6,8-10H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | GQIDTZTWJRXCNJ-LSDHHAIUSA-N |
| XLogP | 3.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|