About 7-bromo-1-methyl-5,7a-dihydroindazole
7-bromo-1-methyl-5,7a-dihydroindazole (PubChem CID 91556615) has the molecular formula C8H9BrN2
and a molecular weight of 213.08 g/mol. Its IUPAC name is 7-bromo-1-methyl-5,7a-dihydroindazole.
Molecular Properties
| Compound Name | 7-bromo-1-methyl-5,7a-dihydroindazole |
| PubChem CID | 91556615 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 7-bromo-1-methyl-5,7a-dihydroindazole |
| SMILES | CN1N=CC2=CCC=C(Br)C21 |
| InChI | InChI=1S/C8H9BrN2/c1-11-8-6(5-10-11)3-2-4-7(8)9/h3-5,8H,2H2,1H3 |
| InChIKey | AJHCNWOOKIXFOF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-1-methyl-5,7a-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-methyl-5,7a-dihydroindazole?
The IUPAC name of 7-bromo-1-methyl-5,7a-dihydroindazole (CID 91556615) is 7-bromo-1-methyl-5,7a-dihydroindazole.
What is the SMILES notation for 7-bromo-1-methyl-5,7a-dihydroindazole?
The canonical SMILES for 7-bromo-1-methyl-5,7a-dihydroindazole is CN1N=CC2=CCC=C(Br)C21.
What is the InChIKey of 7-bromo-1-methyl-5,7a-dihydroindazole?
The InChIKey is AJHCNWOOKIXFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2/c1-11-8-6(5-10-11)3-2-4-7(8)9/h3-5,8H,2H2,1H3.
What are the key properties of 7-bromo-1-methyl-5,7a-dihydroindazole?
7-bromo-1-methyl-5,7a-dihydroindazole has a molecular weight of 213.08 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-methyl-5,7a-dihydroindazole is sourced from PubChem (CID 91556615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).